|
CAS#: 6073-72-9 Product: Ethyl 2-(2-Methyl-2-Propanyl)-4,6-Dinitrophenyl Carbonate No suppilers available for the product. |
| Name | Ethyl 2-(2-Methyl-2-Propanyl)-4,6-Dinitrophenyl Carbonate |
|---|---|
| Synonyms | Dinoterbon |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 |
| CAS Registry Number | 6073-72-9 |
| SMILES | O=C(Oc1c(cc(cc1C(C)(C)C)[N+]([O-])=O)[N+]([O-])=O)OCC |
| InChI | 1S/C13H16N2O7/c1-5-21-12(16)22-11-9(13(2,3)4)6-8(14(17)18)7-10(11)15(19)20/h6-7H,5H2,1-4H3 |
| InChIKey | IXNUTQCZWAHNPN-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.1°C at 760 mmHg (Cal.) |
| Flash point | 161.706°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-(2-Methyl-2-Propanyl)-4,6-Dinitrophenyl Carbonate |