|
CAS#: 60776-05-8 Product: 4,4'-Dipyridylmethane No suppilers available for the product. |
| Name | 4,4'-Dipyridylmethane |
|---|---|
| Synonyms | 4-(4-Pyridylmethyl)Pyridine; 4,4'-Dipyridylmethane; 4,4'-Methylenebis(Pyridine) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 |
| CAS Registry Number | 60776-05-8 |
| SMILES | C1=CC(=CC=N1)CC2=CC=NC=C2 |
| InChI | 1S/C11H10N2/c1-5-12-6-2-10(1)9-11-3-7-13-8-4-11/h1-8H,9H2 |
| InChIKey | VJCSMTPTFZQWNS-UHFFFAOYSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.42°C at 760 mmHg (Cal.) |
| Flash point | 119.56°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dipyridylmethane |