Online Database of Chemicals from Around the World
|
CAS#: 60834-76-6 Product: 2,5-Diisopropyl-3,4-Xylenol No suppilers available for the product. |
| Name | 2,5-Diisopropyl-3,4-Xylenol |
|---|---|
| Synonyms | 2,5-Diisopropyl-3,4-Dimethyl-Phenol; 2,5-Diisopropyl-3,4-Dimethylphenol; 2,5-Diisopropyl-3,4-Xylenol |
| Molecular Structure |  |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 |
| CAS Registry Number | 60834-76-6 |
| EINECS | 262-455-3 |
| SMILES | C1=C(C(=C(C(=C1C(C)C)C)C)C(C)C)O |
| InChI | 1S/C14H22O/c1-8(2)12-7-13(15)14(9(3)4)11(6)10(12)5/h7-9,15H,1-6H3 |
| InChIKey | MEWKMHMKBLDOOH-UHFFFAOYSA-N |
| Density | 0.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.51°C at 760 mmHg (Cal.) |
| Flash point | 137.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diisopropyl-3,4-Xylenol |