Online Database of Chemicals from Around the World
|
CAS#: 60851-34-5 Product: 2,3,4,6,7,8-Hexachlorodibenzofuran No suppilers available for the product. |
| Name | 2,3,4,6,7,8-Hexachlorodibenzofuran |
|---|---|
| Synonyms | 2,3,4,6,7,8-Hexachlorodibenzofuran [Dioxin And Dioxin-Like Compounds]; Dibenzofuran, 2,3,4,6,7,8-Hexachloro-; F 130 |
| Molecular Structure |  |
| Molecular Formula | C12H2Cl6O |
| Molecular Weight | 374.87 |
| CAS Registry Number | 60851-34-5 |
| SMILES | C1=C(C(=C(C3=C1C2=CC(=C(C(=C2O3)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O/c13-5-1-3-4-2-6(14)8(16)10(18)12(4)19-11(3)9(17)7(5)15/h1-2H |
| InChIKey | XTAHLACQOVXINQ-UHFFFAOYSA-N |
| Density | 1.767g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.747°C at 760 mmHg (Cal.) |
| Flash point | 243.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6,7,8-Hexachlorodibenzofuran |