|
CAS#: 6091-05-0 Product: Physovenine No suppilers available for the product. |
| Name | Physovenine |
|---|---|
| Synonyms | N-Methylcarbamic Acid [(3As,8Bs)-4,8B-Dimethyl-2,3A-Dihydro-1H-Furo[2,3-B]Indol-7-Yl] Ester; C09232; Physovenine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 |
| CAS Registry Number | 6091-05-0 |
| SMILES | [C@@H]23N(C1=CC=C(OC(=O)NC)C=C1[C@@]2(CCO3)C)C |
| InChI | 1S/C14H18N2O3/c1-14-6-7-18-12(14)16(3)11-5-4-9(8-10(11)14)19-13(17)15-2/h4-5,8,12H,6-7H2,1-3H3,(H,15,17)/t12-,14-/m0/s1 |
| InChIKey | LXTKNVLLWOLCOV-JSGCOSHPSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 194.5±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Physovenine |