|
CAS#: 60937-65-7 Product: Aposafranine No suppilers available for the product. |
| Name | Aposafranine |
|---|---|
| Synonyms | (5-Phenyl-4,4A-Dihydrophenazin-10-Ium-2-Yl)Amine Chloride; 3-Amino-10-Phenylphenazinium Chloride; Aposafranine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.81 |
| CAS Registry Number | 60937-65-7 |
| SMILES | C1=CC=CC3=C1[NH2+]C2=CC(=CCC2N3C4=CC=CC=C4)N.[Cl-] |
| InChI | 1S/C18H17N3.ClH/c19-13-10-11-18-16(12-13)20-15-8-4-5-9-17(15)21(18)14-6-2-1-3-7-14;/h1-10,12,18,20H,11,19H2;1H |
| InChIKey | MWXMWLZIZRDIBL-UHFFFAOYSA-N |
| Boiling point | 469.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aposafranine |