|
CAS#: 609779-51-3 Product: 2,3-difluoro-1-methoxy-4-(4-propylcyclohexyl)benzene No suppilers available for the product. |
| Name | 2,3-difluoro-1-methoxy-4-(4-propylcyclohexyl)benzene |
|---|---|
| Synonyms | trans-2,3-Difluoro-1-methoxy-4-(4-propyl-cyclohexyl)-benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.34 |
| CAS Registry Number | 609779-51-3 |
| SMILES | CCC[C@H]1CC[C@@H](CC1)c2c(c(c(cc2)OC)F)F |
| InChI | 1S/C16H22F2O/c1-3-4-11-5-7-12(8-6-11)13-9-10-14(19-2)16(18)15(13)17/h9-12H,3-8H2,1-2H3/t11-,12- |
| InChIKey | IMPPBANBBAQKPL-HAQNSBGRSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.012°C at 760 mmHg (Cal.) |
| Flash point | 148.437°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-difluoro-1-methoxy-4-(4-propylcyclohexyl)benzene |