|
CAS#: 61009-11-8 Product: Diammonium 2,2'-Methylenedi(1-Naphthalenesulfonate) No suppilers available for the product. |
| Name | Diammonium 2,2'-Methylenedi(1-Naphthalenesulfonate) |
|---|---|
| Synonyms | diammonium methylenebisnaphthalenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.54 |
| CAS Registry Number | 61009-11-8 |
| EINECS | 262-557-8 |
| SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)c3c4ccccc4ccc3Cc2ccc1ccccc1c2S([O-])(=O)=O |
| InChI | 1S/C21H16O6S2.2H3N/c22-28(23,24)20-16(11-9-14-5-1-3-7-18(14)20)13-17-12-10-15-6-2-4-8-19(15)21(17)29(25,26)27;;/h1-12H,13H2,(H,22,23,24)(H,25,26,27);2*1H3 |
| InChIKey | IYAZIAWDRDGKKX-UHFFFAOYSA-N |
| Boiling point | 832.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 457.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diammonium 2,2'-Methylenedi(1-Naphthalenesulfonate) |