|
CAS#: 61031-72-9 Product: alpha,alpha-Dichlorophenylacetic Acid No suppilers available for the product. |
| Name | alpha,alpha-Dichlorophenylacetic Acid |
|---|---|
| Synonyms | 2,2-Dichloro-2-Phenyl-Acetic Acid; 2,2-Dichloro-2-Phenyl-Ethanoic Acid; Alpha,Alpha-Dichlorophenylacetic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 |
| CAS Registry Number | 61031-72-9 |
| SMILES | C1=CC=CC=C1C(C(=O)O)(Cl)Cl |
| InChI | 1S/C8H6Cl2O2/c9-8(10,7(11)12)6-4-2-1-3-5-6/h1-5H,(H,11,12) |
| InChIKey | MENJBAPSEVYSIK-UHFFFAOYSA-N |
| Density | 1.459g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.904°C at 760 mmHg (Cal.) |
| Flash point | 133.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Dichlorophenylacetic Acid |