Online Database of Chemicals from Around the World
| Name | 3,3-Dimethylbutyric Acid Benzyl Ester |
|---|---|
| Synonyms | 3,3-Dimethylbutanoic Acid Phenylmethyl Ester; 3,3-Dimethylbutyric Acid Benzyl Ester; Butanoic Acid, 3,3-Dimethyl-, Phenylmethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 61066-88-4 |
| SMILES | C1=CC=C(C=C1)COC(=O)CC(C)(C)C |
| InChI | 1S/C13H18O2/c1-13(2,3)9-12(14)15-10-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3 |
| InChIKey | WLTKXQISYPBOSS-UHFFFAOYSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.871°C at 760 mmHg (Cal.) |
| Flash point | 97.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethylbutyric Acid Benzyl Ester |
