Online Database of Chemicals from Around the World
|
CAS#: 61103-89-7 Product: Austina No suppilers available for the product. |
| Name | Austina |
|---|---|
| Synonyms | Nsc280416 |
| Molecular Structure |  |
| Molecular Formula | C27H32O9 |
| Molecular Weight | 500.54 |
| CAS Registry Number | 61103-89-7 |
| SMILES | CC23C15C(C(=O)OC(C1=C)(C(OC(=O)C)C2=C(C)C4(CC3)C(OC(C=C4)=O)(C)C)C)(C(C)OC5=O)O |
| InChI | 1S/C27H32O9/c1-13-18-19(34-16(4)28)24(8)14(2)26(20(30)33-15(3)27(26,32)21(31)36-24)23(18,7)11-12-25(13)10-9-17(29)35-22(25,5)6/h9-10,15,19,32H,2,11-12H2,1,3-8H3 |
| InChIKey | DEMDOYQPCDXCEB-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.657°C at 760 mmHg (Cal.) |
| Flash point | 235.365°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Austina |