|
CAS#: 611225-63-9 Product: 2-Methyl-2-propanyl 4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinecarboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinecarboxylate |
|---|---|
| Synonyms | 2-Pyridin |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.35 |
| CAS Registry Number | 611225-63-9 |
| SMILES | O=N(=O)c1cc(ccc1NC)Oc2ccnc(c2)C(=O)OC(C)(C)C |
| InChI | 1S/C17H19N3O5/c1-17(2,3)25-16(21)14-9-12(7-8-19-14)24-11-5-6-13(18-4)15(10-11)20(22)23/h5-10,18H,1-4H3 |
| InChIKey | GSISGLUKVBMUJB-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.734°C at 760 mmHg (Cal.) |
| Flash point | 254.821°C (Cal.) |
| Refractive index | 1.596 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 4-[4-(methylamino)-3-nitrophenoxy]-2-pyridinecarboxylate |