|
CAS#: 61142-14-1 Product: 1,6-Dimethyl-3,4-Divinylcyclohexene No suppilers available for the product. |
| Name | 1,6-Dimethyl-3,4-Divinylcyclohexene |
|---|---|
| Synonyms | 1,6-Dimethyl-3,4-divinyl-1-cyclohexene # |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.27 |
| CAS Registry Number | 61142-14-1 |
| SMILES | C(=C)\C1\C=C(/C(C)CC1\C=C)C |
| InChI | 1S/C12H18/c1-5-11-7-9(3)10(4)8-12(11)6-2/h5-7,10-12H,1-2,8H2,3-4H3 |
| InChIKey | VTXVMAQBEQLHGL-UHFFFAOYSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.991°C at 760 mmHg (Cal.) |
| Flash point | 64.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dimethyl-3,4-Divinylcyclohexene |