Online Database of Chemicals from Around the World
|
CAS#: 61168-62-5 Product: Ammonium Ethylbenzenesulphonate No suppilers available for the product. |
| Name | Ammonium Ethylbenzenesulphonate |
|---|---|
| Synonyms | Ammonium 2-Ethylbenzenesulfonate; Ammonium Ethylbenzenesulfonate; Ammonium Ethylbenzenesulphonate |
| Molecular Structure |  |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 |
| CAS Registry Number | 61168-62-5 |
| EINECS | 262-636-7 |
| SMILES | C1=C(CC)C(=CC=C1)[S]([O-])(=O)=O.[NH4+] |
| InChI | 1S/C8H10O3S.H3N/c1-2-7-5-3-4-6-8(7)12(9,10)11;/h3-6H,2H2,1H3,(H,9,10,11);1H3 |
| InChIKey | KWYUNQQDYXTBAB-UHFFFAOYSA-N |
| Boiling point | 409.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Ethylbenzenesulphonate |