Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 2,4'-Dinitrodiphenylamine |
|---|---|
| Synonyms | (2-Nitrophenyl)-(4-Nitrophenyl)Amine; 2,4'-Dinitrodiphenylamine; Benzenamine, 2-Nitro-N-(4-Nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 |
| CAS Registry Number | 612-36-2 |
| EINECS | 210-306-8 |
| SMILES | C2=C(NC1=C([N+]([O-])=O)C=CC=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C12H9N3O4/c16-14(17)10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)15(18)19/h1-8,13H |
| InChIKey | TXJIDOLTOGSNPD-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.268°C at 760 mmHg (Cal.) |
| Flash point | 216.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4'-Dinitrodiphenylamine |