|
CAS#: 612051-42-0 Product: 3,4-Dibromophenylalanine No suppilers available for the product. |
| Name | 3,4-Dibromophenylalanine |
|---|---|
| Synonyms | DL-3,4-Dibromophenylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 |
| CAS Registry Number | 612051-42-0 |
| SMILES | Brc1ccc(cc1Br)CC(C(=O)O)N |
| InChI | 1S/C9H9Br2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| InChIKey | GHRHPYLXAMYVSJ-UHFFFAOYSA-N |
| Density | 1.902g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.165°C at 760 mmHg (Cal.) |
| Flash point | 212.142°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dibromophenylalanine |