|
CAS#: 61217-79-6 Product: (2-Hydroxy-2-Phenyl-Ethyl)-Methyl-Azanium Chloride No suppilers available for the product. |
| Name | (2-Hydroxy-2-Phenyl-Ethyl)-Methyl-Azanium Chloride |
|---|---|
| Synonyms | (2-Hydroxy-2-Phenyl-Ethyl)-Methyl-Ammonium Chloride; (2-Hydroxy-2-Phenylethyl)-Methylammonium Chloride; (2-Hydroxy-2-Phenyl-Ethyl)-Methyl-Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 |
| CAS Registry Number | 61217-79-6 |
| SMILES | C1=C(C(O)C[NH2+]C)C=CC=C1.[Cl-] |
| InChI | 1S/C9H13NO.ClH/c1-10-7-9(11)8-5-3-2-4-6-8;/h2-6,9-11H,7H2,1H3;1H |
| InChIKey | NPUGYWPZOLONFA-UHFFFAOYSA-N |
| Boiling point | 244.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 96.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Hydroxy-2-Phenyl-Ethyl)-Methyl-Azanium Chloride |