|
CAS#: 61227-20-1 Product: 5-Cyano-1,3-Phenylene Diacetate No suppilers available for the product. |
| Name | 5-Cyano-1,3-Phenylene Diacetate |
|---|---|
| Synonyms | 3,5-DIACETOXYBENZONITRILE; 5-Cyan-1,3-phenylen-diacetat; 5-Cyano-1,3-phenylene diacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.19 |
| CAS Registry Number | 61227-20-1 |
| SMILES | CC(=O)Oc1cc(cc(c1)OC(=O)C)C#N |
| InChI | 1S/C11H9NO4/c1-7(13)15-10-3-9(6-12)4-11(5-10)16-8(2)14/h3-5H,1-2H3 |
| InChIKey | IKRWTLZULWJDJS-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.3±32.0°C at 760 mmHg (Cal.) |
| Flash point | 145.2±15.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Cyano-1,3-Phenylene Diacetate |