|
CAS#: 6127-51-1 Product: 5-Methoxy-1H-Indole-3-Ethanol 3-Acetate No suppilers available for the product. |
| Name | 5-Methoxy-1H-Indole-3-Ethanol 3-Acetate |
|---|---|
| Synonyms | Acetic Acid 2-(5-Methoxy-1H-Indol-3-Yl)Ethyl Ester; 2-(5-Methoxy-1H-Indol-3-Yl)Ethyl Ethanoate; 1H-Indole-3-Ethanol, 5-Methoxy, Acetate (Ester) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 |
| CAS Registry Number | 6127-51-1 |
| SMILES | C1=C(C2=C([NH]1)C=CC(=C2)OC)CCOC(C)=O |
| InChI | 1S/C13H15NO3/c1-9(15)17-6-5-10-8-14-13-4-3-11(16-2)7-12(10)13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | HVYLYRVBNPNNMU-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.547°C at 760 mmHg (Cal.) |
| Flash point | 195.439°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-1H-Indole-3-Ethanol 3-Acetate |