Online Database of Chemicals from Around the World
| Name | 3-Oxobutanoic Acid 4-Methoxybenzyl Ester |
|---|---|
| Synonyms | 3-Oxobutanoic Acid (4-Methoxyphenyl)Methyl Ester; 3-Ketobutyric Acid (4-Methoxybenzyl) Ester; Butanoic Acid, 3-Oxo-, (4-Methoxyphenyl)Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 61312-35-4 |
| SMILES | C1=C(C=CC(=C1)COC(=O)CC(=O)C)OC |
| InChI | 1S/C12H14O4/c1-9(13)7-12(14)16-8-10-3-5-11(15-2)6-4-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | KDHRQKPVXJRBIX-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.623°C at 760 mmHg (Cal.) |
| Flash point | 142.143°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Oxobutanoic Acid 4-Methoxybenzyl Ester |
