|
CAS#: 61341-42-2 Product: Sodium Thiophen-2-Acetate No suppilers available for the product. |
| Name | Sodium Thiophen-2-Acetate |
|---|---|
| Synonyms | Sodium 2-(2-Thienyl)Acetate; Sodium 2-Thiophen-2-Ylethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5NaO2S |
| Molecular Weight | 164.15 |
| CAS Registry Number | 61341-42-2 |
| EINECS | 262-726-6 |
| SMILES | C1=C(SC=C1)CC([O-])=O.[Na+] |
| InChI | 1S/C6H6O2S.Na/c7-6(8)4-5-2-1-3-9-5;/h1-3H,4H2,(H,7,8);/q;+1/p-1 |
| InChIKey | RSASPWMZKNIURZ-UHFFFAOYSA-M |
| Boiling point | 269.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Thiophen-2-Acetate |