Online Database of Chemicals from Around the World
|
CAS#: 61381-91-7 Product: 4,4'-Oxybis[2,6-Dibromoaniline] No suppilers available for the product. |
| Name | 4,4'-Oxybis[2,6-Dibromoaniline] |
|---|---|
| Synonyms | 4-(4-Amino-3,5-Dibromo-Phenoxy)-2,6-Dibromo-Aniline; [4-(4-Amino-3,5-Dibromo-Phenoxy)-2,6-Dibromo-Phenyl]Amine; 4,4'-Oxybis(2,6-Dibromoaniline) |
| Molecular Structure | ![CAS#: 61381-91-7, 4,4'-Oxybis[2,6-Dibromoaniline]](/moreStructures/61381-91-7.gif) |
| Molecular Formula | C12H8Br4N2O |
| Molecular Weight | 515.82 |
| CAS Registry Number | 61381-91-7 |
| EINECS | 262-753-3 |
| SMILES | C1=C(C(=C(C=C1OC2=CC(=C(C(=C2)Br)N)Br)Br)N)Br |
| InChI | 1S/C12H8Br4N2O/c13-7-1-5(2-8(14)11(7)17)19-6-3-9(15)12(18)10(16)4-6/h1-4H,17-18H2 |
| InChIKey | XILHJTXOEMTUQR-UHFFFAOYSA-N |
| Density | 2.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.951°C at 760 mmHg (Cal.) |
| Flash point | 247.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Oxybis[2,6-Dibromoaniline] |