|
CAS#: 61405-55-8 Product: 2,3,4,5,6-Pentahydroxy-7-Oxoheptyl 2-Amino-2-Deoxy-D-Glucopyranoside No suppilers available for the product. |
| Name | 2,3,4,5,6-Pentahydroxy-7-Oxoheptyl 2-Amino-2-Deoxy-D-Glucopyranoside |
|---|---|
| Synonyms | 7-O-(2-amino-2-deoxyglucopyranosyl)heptose |
| Molecular Structure | ![]() |
| Molecular Formula | C13H25NO11 |
| Molecular Weight | 371.34 |
| CAS Registry Number | 61405-55-8 |
| SMILES | O=CC(O)C(O)C(O)C(O)C(O)COC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | 1S/C13H25NO11/c14-7-11(22)10(21)6(2-16)25-13(7)24-3-5(18)9(20)12(23)8(19)4(17)1-15/h1,4-13,16-23H,2-3,14H2/t4?,5?,6-,7-,8?,9?,10-,11-,12?,13?/m1/s1 |
| InChIKey | MKIGIGUARLOPNF-BQVYBEENSA-N |
| Density | 1.664g/cm3 (Cal.) |
|---|---|
| Boiling point | 792.509°C at 760 mmHg (Cal.) |
| Flash point | 433.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5,6-Pentahydroxy-7-Oxoheptyl 2-Amino-2-Deoxy-D-Glucopyranoside |