|
CAS#: 6147-00-8 Product: Manganese Dibutyrate No suppilers available for the product. |
| Name | Manganese Dibutyrate |
|---|---|
| Synonyms | Manganous Butanoate; Manganous Butyrate; Butanoic Acid, Manganese(2+) Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14MnO4 |
| Molecular Weight | 229.13 |
| CAS Registry Number | 6147-00-8 |
| EINECS | 228-154-6 |
| SMILES | C(C([O-])=O)CC.C(C([O-])=O)CC.[Mn++] |
| InChI | 1S/2C4H8O2.Mn/c2*1-2-3-4(5)6;/h2*2-3H2,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | BLMXJJXSWRYMCS-UHFFFAOYSA-L |
| Boiling point | 164.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 69.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese Dibutyrate |