|
CAS#: 615257-52-8 Product: (1S,1'r,4'S)-4-(3,5-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexan)-3-ene No suppilers available for the product. |
| Name | (1S,1'r,4'S)-4-(3,5-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexan)-3-ene |
|---|---|
| Synonyms | Benzene, |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26F2 |
| Molecular Weight | 304.42 |
| CAS Registry Number | 615257-52-8 |
| SMILES | CC[C@H]1CC[C@@H](CC1)C2CC=C(CC2)c3cc(cc(c3)F)F |
| InChI | 1S/C20H26F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)18-11-19(21)13-20(22)12-18/h9,11-16H,2-8,10H2,1H3/t14-,15-,16? |
| InChIKey | PUUMKNJBGNYNGT-MRJYIUEKSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.51°C at 760 mmHg (Cal.) |
| Flash point | 154.671°C (Cal.) |
| Refractive index | 1.514 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,1'r,4'S)-4-(3,5-Difluorophenyl)-4'-ethyl-1,1'-bi(cyclohexan)-3-ene |