|
CAS#: 61540-35-0 Product: Cyanomethyl Dimethyldithiocarbamate No suppilers available for the product. |
| Name | Cyanomethyl Dimethyldithiocarbamate |
|---|---|
| Synonyms | Dimethylaminomethanedithioic Acid Cyanomethyl Ester; Inchi=1/C5h8n2s2/C1-7(2)5(8)9-4-3-6/H4h2,1-2H; Cyanomethyl Dimethyldithiocarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.25 |
| CAS Registry Number | 61540-35-0 |
| EINECS | 262-833-8 |
| SMILES | C(SC(=S)N(C)C)C#N |
| InChI | 1S/C5H8N2S2/c1-7(2)5(8)9-4-3-6/h4H2,1-2H3 |
| InChIKey | LVCZXSPJNILIPO-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Cyanomethyl Dimethyldithiocarbamate |