|
CAS#: 6163-35-5 Product: 2,3,4,6-Tetra-O-Methyl-alpha-D-Glucose No suppilers available for the product. |
| Name | 2,3,4,6-Tetra-O-Methyl-alpha-D-Glucose |
|---|---|
| Synonyms | (2S,3R,4S,5R,6R)-3,4,5-Trimethoxy-6-(Methoxymethyl)Tetrahydropyran-2-Ol; (2S,3R,4S,5R,6R)-3,4,5-Trimethoxy-6-(Methoxymethyl)-2-Tetrahydropyranol; 2,3,4,6-Tetra-O-Methyl-Alpha-D-Glucose |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 |
| CAS Registry Number | 6163-35-5 |
| EINECS | 228-192-3 |
| SMILES | [C@@H]1([C@@H]([C@H]([C@H](O[C@@H]1COC)O)OC)OC)OC |
| InChI | 1S/C10H20O6/c1-12-5-6-7(13-2)8(14-3)9(15-4)10(11)16-6/h6-11H,5H2,1-4H3/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | AQWPITGEZPPXTJ-SPFKKGSWSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.372°C at 760 mmHg (Cal.) |
| Flash point | 149.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6-Tetra-O-Methyl-alpha-D-Glucose |