|
CAS#: 61689-36-9 Product: Ethyl 5-(4-Chlorophenyl)-1,2,4-Thiadiazole-3-Carboxylate No suppilers available for the product. |
| Name | Ethyl 5-(4-Chlorophenyl)-1,2,4-Thiadiazole-3-Carboxylate |
|---|---|
| Synonyms | Ethyl 5-(4-chlorophenyl)-1,2,4-thiadiazole-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 |
| CAS Registry Number | 61689-36-9 |
| SMILES | O=C(OCC)c1nc(sn1)c2ccc(Cl)cc2 |
| InChI | 1S/C11H9ClN2O2S/c1-2-16-11(15)9-13-10(17-14-9)7-3-5-8(12)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | KJCPXZTZWDQJJU-UHFFFAOYSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.741°C at 760 mmHg (Cal.) |
| Flash point | 191.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 5-(4-Chlorophenyl)-1,2,4-Thiadiazole-3-Carboxylate |