Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-Hexadecamethyl-Heptadecane |
|---|---|
| Synonyms | Heptadecane, 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-Hexadecamethyl- |
| Molecular Structure |  |
| Molecular Formula | C33H68 |
| Molecular Weight | 464.90 |
| CAS Registry Number | 61693-08-1 |
| SMILES | C(C(C)(CC(C)(C)C)C)C(CC(CC(CC(CC(CC(C)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C |
| InChI | 1S/C33H68/c1-26(2,3)19-28(7,8)21-30(11,12)23-32(15,16)25-33(17,18)24-31(13,14)22-29(9,10)20-27(4,5)6/h19-25H2,1-18H3 |
| InChIKey | UCUGLVJQUIRCPK-UHFFFAOYSA-N |
| Density | 0.81g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.075°C at 760 mmHg (Cal.) |
| Flash point | 247.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4,6,6,8,8,10,10,12,12,14,14,16,16-Hexadecamethyl-Heptadecane |