|
CAS#: 61695-72-5 Product: 7-Benzanthryloxirane No suppilers available for the product. |
| Name | 7-Benzanthryloxirane |
|---|---|
| Synonyms | 2-(7-Benzo[B]Phenanthrenyl)Oxirane; Benz(A)Anthracene, 7-(Epoxyethyl)-; Oxirane, Benz(A)Anthracen-7-Yl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O |
| Molecular Weight | 270.33 |
| CAS Registry Number | 61695-72-5 |
| SMILES | C1=CC2=C(C=C1)C3=C(C=C2)C(=C4C(=C3)C=CC=C4)C5CO5 |
| InChI | 1S/C20H14O/c1-3-7-15-13(5-1)9-10-17-18(15)11-14-6-2-4-8-16(14)20(17)19-12-21-19/h1-11,19H,12H2 |
| InChIKey | CKLWGOVDWZSDQU-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.233°C at 760 mmHg (Cal.) |
| Flash point | 245.183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Benzanthryloxirane |