|
CAS#: 61719-86-6 Product: 4-Nitro-7,9-Bis(Trichloromethyl)-8,10-Dioxabicyclo[4.4.0]Deca-2,4,11-Triene No suppilers available for the product. |
| Name | 4-Nitro-7,9-Bis(Trichloromethyl)-8,10-Dioxabicyclo[4.4.0]Deca-2,4,11-Triene |
|---|---|
| Synonyms | Nsc14838 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl6NO4 |
| Molecular Weight | 415.87 |
| CAS Registry Number | 61719-86-6 |
| SMILES | C1=C2C(=CC(=C1)[N+]([O-])=O)C(OC(C(Cl)(Cl)Cl)O2)C(Cl)(Cl)Cl |
| InChI | 1S/C10H5Cl6NO4/c11-9(12,13)7-5-3-4(17(18)19)1-2-6(5)20-8(21-7)10(14,15)16/h1-3,7-8H |
| InChIKey | RCTXAWWKLZRCFU-UHFFFAOYSA-N |
| Density | 1.793g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.367°C at 760 mmHg (Cal.) |
| Flash point | 237.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-7,9-Bis(Trichloromethyl)-8,10-Dioxabicyclo[4.4.0]Deca-2,4,11-Triene |