|
CAS#: 61735-78-2 Product: 2,10-Difluorobenzo(a,i)Pyrene No suppilers available for the product. |
| Name | 2,10-Difluorobenzo(a,i)Pyrene |
|---|---|
| Synonyms | Benzo(Rst)Pentaphene, 2,10-Difluoro-; Brn 2006947; 2,10-Difluorobenzo(A,I)Pyrene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H12F2 |
| Molecular Weight | 338.36 |
| CAS Registry Number | 61735-78-2 |
| SMILES | C1=C(F)C=CC2=C1C6=C3C(=C2)C=CC4=C3C(=C5C(=C4)C=C(F)C=C5)C=C6 |
| InChI | 1S/C24H12F2/c25-17-5-6-19-16(11-17)10-15-2-1-14-9-13-3-4-18(26)12-22(13)21-8-7-20(19)23(15)24(14)21/h1-12H |
| InChIKey | VWZJCJJPDPIZMY-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.304°C at 760 mmHg (Cal.) |
| Flash point | 248.518°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,10-Difluorobenzo(a,i)Pyrene |