|
CAS#: 61748-93-4 Product: Estradiol-17 beta-Decanoate No suppilers available for the product. |
| Name | Estradiol-17 beta-Decanoate |
|---|---|
| Synonyms | Decanoic Acid [(8R,9S,13S,14S,17S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ester; Capric Acid [(8R,9S,13S,14S,17S)-3-Hydroxy-13-Methyl-6,7,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-17-Yl] Ester; 17Beta-Oestradiol Decanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 |
| CAS Registry Number | 61748-93-4 |
| SMILES | [C@H]34[C@H]1[C@@H](C2=C(CC1)C=C(O)C=C2)CC[C@@]3([C@@H](OC(=O)CCCCCCCCC)CC4)C |
| InChI | 1S/C28H42O3/c1-3-4-5-6-7-8-9-10-27(30)31-26-16-15-25-24-13-11-20-19-21(29)12-14-22(20)23(24)17-18-28(25,26)2/h12,14,19,23-26,29H,3-11,13,15-18H2,1-2H3/t23-,24-,25+,26+,28+/m1/s1 |
| InChIKey | YYFQNZXJGOTFRX-VMBLQBCYSA-N |
| Density | 1.081g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.753°C at 760 mmHg (Cal.) |
| Flash point | 205.866°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Estradiol-17 beta-Decanoate |