Online Database of Chemicals from Around the World
|
CAS#: 61774-50-3 Product: 1',4,8''-Trihydroxy-2,3',6''-Trimethyl-1,2':7',2''-Ternaphthalene-1'',4'',5,5',8,8'-Hexone No suppilers available for the product. |
| Name | 1',4,8''-Trihydroxy-2,3',6''-Trimethyl-1,2':7',2''-Ternaphthalene-1'',4'',5,5',8,8'-Hexone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C33H20O9 |
| Molecular Weight | 560.51 |
| CAS Registry Number | 61774-50-3 |
| SMILES | O=C\1c6c(C(=O)/C=C/1)c(O)cc(c6c2c(cc3c(c2O)C(=O)C(=C\C3=O)/C5=C/C(=O)c4cc(cc(O)c4C5=O)C)C)C |
| InChI | 1S/C33H20O9/c1-12-6-17-21(36)10-15(31(40)27(17)23(38)7-12)16-11-22(37)18-8-13(2)26(33(42)28(18)32(16)41)25-14(3)9-24(39)29-19(34)4-5-20(35)30(25)29/h4-11,38-39,42H,1-3H3 |
| InChIKey | DFNNCHYNXVUZKI-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Boiling point | 855.763°C at 760 mmHg (Cal.) |
| Flash point | 485.205°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1',4,8''-Trihydroxy-2,3',6''-Trimethyl-1,2':7',2''-Ternaphthalene-1'',4'',5,5',8,8'-Hexone |