|
CAS#: 61792-12-9 Product: Cinnamyl Tiglate No suppilers available for the product. |
| Name | Cinnamyl Tiglate |
|---|---|
| Synonyms | (E)-2-Methylbut-2-Enoic Acid [(E)-3-Phenylprop-2-Enyl] Ester; 2-Butenoic Acid, 2-Methyl-, 3-Phenyl-2-Propenyl Ester, (2E)-; 2-Butenoic Acid, 2-Methyl-, 3-Phenyl-2-Propenyl Ester, (E,?)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 61792-12-9 |
| EINECS | 263-215-0 |
| SMILES | C1=C(\C=C\COC(C(=C/C)/C)=O)C=CC=C1 |
| InChI | 1S/C14H16O2/c1-3-12(2)14(15)16-11-7-10-13-8-5-4-6-9-13/h3-10H,11H2,1-2H3/b10-7+,12-3+ |
| InChIKey | KRNURAJANZKGQN-IBIBRXRCSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.478°C at 760 mmHg (Cal.) |
| Flash point | 198.161°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cinnamyl Tiglate |