|
CAS#: 618-22-4 Product: 4-Acetamidophenylarsonic Acid No suppilers available for the product. |
| Name | 4-Acetamidophenylarsonic Acid |
|---|---|
| Synonyms | Nci60_000855; 4-Acetamidophenylarsonic Acid; Acide Acetamido-4 Benzene Arsonique [French] |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10AsNO4 |
| Molecular Weight | 259.09 |
| CAS Registry Number | 618-22-4 |
| EINECS | 210-541-6 |
| SMILES | C1=C([As](=O)(O)O)C=CC(=C1)NC(=O)C |
| InChI | 1S/C8H10AsNO4/c1-6(11)10-8-4-2-7(3-5-8)9(12,13)14/h2-5H,1H3,(H,10,11)(H2,12,13,14) |
| InChIKey | LTGKKKITNWDUCD-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 4-Acetamidophenylarsonic Acid |