|
CAS#: 6184-11-8 Product: Lysine 4-Nitroanilide No suppilers available for the product. |
| Name | Lysine 4-Nitroanilide |
|---|---|
| Synonyms | Lysyl-P-Nitroanilide; Hexanamide, 2,6-Diamino-N-(4-Nitrophenyl)-; Lysine 4-Nitroanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 6184-11-8 |
| SMILES | [C@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])(N)CCCCN |
| InChI | 1S/C12H18N4O3/c13-8-2-1-3-11(14)12(17)15-9-4-6-10(7-5-9)16(18)19/h4-7,11H,1-3,8,13-14H2,(H,15,17)/t11-/m0/s1 |
| InChIKey | VUUNELJIFNFWJC-NSHDSACASA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.7°C at 760 mmHg (Cal.) |
| Flash point | 275.363°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lysine 4-Nitroanilide |