|
CAS#: 6187-24-2 Product: 3-Nitro-3-Heptene No suppilers available for the product. |
| Name | 3-Nitro-3-Heptene |
|---|---|
| Synonyms | 3-Heptene, 3-Nitro-; 3-Nitro-3-Heptene; Brn 1703519 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 |
| CAS Registry Number | 6187-24-2 |
| SMILES | C(\C([N+]([O-])=O)=C\CCC)C |
| InChI | 1S/C7H13NO2/c1-3-5-6-7(4-2)8(9)10/h6H,3-5H2,1-2H3/b7-6- |
| InChIKey | GWDKXPLSCZJVHP-SREVYHEPSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 208.611°C at 760 mmHg (Cal.) |
| Flash point | 74.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-3-Heptene |