|
CAS#: 61888-68-4 Product: 4'-Chloro-5-Methoxy-3-Biphenylpropionic Acid No suppilers available for the product. |
| Name | 4'-Chloro-5-Methoxy-3-Biphenylpropionic Acid |
|---|---|
| Synonyms | 3-[3-(4-Chlorophenyl)-5-Methoxy-Phenyl]Propanoic Acid; 3-[3-(4-Chlorophenyl)-5-Methoxy-Phenyl]Propionic Acid; 3-Biphenylpropionic Acid, 4'-Chloro-5-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 |
| CAS Registry Number | 61888-68-4 |
| SMILES | C2=C(C1=CC=C(C=C1)Cl)C=C(C=C2CCC(O)=O)OC |
| InChI | 1S/C16H15ClO3/c1-20-15-9-11(2-7-16(18)19)8-13(10-15)12-3-5-14(17)6-4-12/h3-6,8-10H,2,7H2,1H3,(H,18,19) |
| InChIKey | AYVTVYUNJPRWEQ-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.488°C at 760 mmHg (Cal.) |
| Flash point | 224.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-5-Methoxy-3-Biphenylpropionic Acid |