|
CAS#: 61927-06-8 Product: 4'-Chloro-5-Propoxy-3-Biphenylacetic Acid No suppilers available for the product. |
| Name | 4'-Chloro-5-Propoxy-3-Biphenylacetic Acid |
|---|---|
| Synonyms | 2-[3-(4-Chlorophenyl)-5-Propoxy-Phenyl]Acetic Acid; 2-[3-(4-Chlorophenyl)-5-Propoxy-Phenyl]Ethanoic Acid; 3-Biphenylacetic Acid, 4'-Chloro-5-Propoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 |
| CAS Registry Number | 61927-06-8 |
| SMILES | C1=C(CC(O)=O)C=C(C=C1OCCC)C2=CC=C(C=C2)Cl |
| InChI | 1S/C17H17ClO3/c1-2-7-21-16-9-12(10-17(19)20)8-14(11-16)13-3-5-15(18)6-4-13/h3-6,8-9,11H,2,7,10H2,1H3,(H,19,20) |
| InChIKey | SZTJOZJNKITFNG-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.049°C at 760 mmHg (Cal.) |
| Flash point | 230.82°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-5-Propoxy-3-Biphenylacetic Acid |