|
CAS#: 61931-86-0 Product: Methyl 2-Phenylthio-6-Quinolyl Ether No suppilers available for the product. |
| Name | Methyl 2-Phenylthio-6-Quinolyl Ether |
|---|---|
| Synonyms | 6-Methoxy-2-Phenylsulfanyl-Quinoline; 6-Methoxy-2-(Phenylthio)Quinoline; Nciopen2_002323 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.34 |
| CAS Registry Number | 61931-86-0 |
| EINECS | 263-342-1 |
| SMILES | C1=C2C(=CC(=C1)OC)C=CC(=N2)SC3=CC=CC=C3 |
| InChI | 1S/C16H13NOS/c1-18-13-8-9-15-12(11-13)7-10-16(17-15)19-14-5-3-2-4-6-14/h2-11H,1H3 |
| InChIKey | APNJFVPUIDYMQH-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.253°C at 760 mmHg (Cal.) |
| Flash point | 221.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Phenylthio-6-Quinolyl Ether |