|
CAS#: 6196-57-2 Product: 3-Deoxyhexulose No suppilers available for the product. |
| Name | 3-Deoxyhexulose |
|---|---|
| Synonyms | 3-Deoxyhexulose; D-Erythro-2-Hexulose, 3-Deoxy-; 3-Deoxy-D-Erythro-Hexulose |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 |
| CAS Registry Number | 6196-57-2 |
| SMILES | [C@@H](CC(CO)=O)(O)[C@H](O)CO |
| InChI | 1S/C6H12O5/c7-2-4(9)1-5(10)6(11)3-8/h5-8,10-11H,1-3H2/t5-,6+/m0/s1 |
| InChIKey | OXFWZSUJNURRMW-NTSWFWBYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.644°C at 760 mmHg (Cal.) |
| Flash point | 250.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Deoxyhexulose |