Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054//+86 13424336463 | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1R,3R)-3-Hydroxycyclohexyl]ethanone |
|---|---|
| Synonyms | 1-((1R,3R)-3-hydroxycyclohexyl)ethanone |
| Molecular Structure | ![CAS#: 620158-59-0, 1-[(1R,3R)-3-Hydroxycyclohexyl]ethanone](/moreStructures/620158-59-0.gif) |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 |
| CAS Registry Number | 620158-59-0 |
| SMILES | CC(=O)[C@@H]1CCC[C@H](C1)O |
| InChI | 1S/C8H14O2/c1-6(9)7-3-2-4-8(10)5-7/h7-8,10H,2-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | UDZMPUBATBDTEM-HTQZYQBOSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.3±33.0°C at 760 mmHg (Cal.) |
| Flash point | 99.3±18.0°C (Cal.) |
| Refractive index | 1.483 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R,3R)-3-Hydroxycyclohexyl]ethanone |