Online Database of Chemicals from Around the World
|
CAS#: 62080-79-9 Product: 3,4-Bis(4-Hydroxyphenyl)-3-Hexenol No suppilers available for the product. |
| Name | 3,4-Bis(4-Hydroxyphenyl)-3-Hexenol |
|---|---|
| Synonyms | 4-[(Z)-1-(2-Hydroxyethyl)-2-(4-Hydroxyphenyl)But-1-Enyl]Phenol; 3,4-Bhth; 3,4-Bis(4-Hydroxyphenyl)-3-Hexenol |
| Molecular Structure |  |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 |
| CAS Registry Number | 62080-79-9 |
| SMILES | C2=C(C(=C(C1=CC=C(O)C=C1)/CC)/CCO)C=CC(=C2)O |
| InChI | 1S/C18H20O3/c1-2-17(13-3-7-15(20)8-4-13)18(11-12-19)14-5-9-16(21)10-6-14/h3-10,19-21H,2,11-12H2,1H3/b18-17- |
| InChIKey | AHVATZBFNWVXRV-ZCXUNETKSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.248°C at 760 mmHg (Cal.) |
| Flash point | 230.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Bis(4-Hydroxyphenyl)-3-Hexenol |