|
CAS#: 62105-98-0 Product: 4,6-Difluoroserotonin No suppilers available for the product. |
| Name | 4,6-Difluoroserotonin |
|---|---|
| Synonyms | 3-Indoleethanamine, 4,6-Difluoro-5-Hydroxy-; 1H-Indol-5-Ol, 3-(2-Aminoethyl)-4,6-Difluoro-; 4,6-Difluoro-5-Hydroxytryptamine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 |
| CAS Registry Number | 62105-98-0 |
| SMILES | C1=C(C2=C([NH]1)C=C(C(=C2F)O)F)CCN |
| InChI | 1S/C10H10F2N2O/c11-6-3-7-8(9(12)10(6)15)5(1-2-13)4-14-7/h3-4,14-15H,1-2,13H2 |
| InChIKey | YODGOKJFDASQKQ-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.433°C at 760 mmHg (Cal.) |
| Flash point | 181.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Difluoroserotonin |