|
CAS#: 6217-24-9 Product: Diphenylhydroxyarsine No suppilers available for the product. |
| Name | Diphenylhydroxyarsine |
|---|---|
| Synonyms | Arsine, Diphenylhydroxy-; Arsine, Hydroxydiphenyl-; Diphenylarsinous Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11AsO |
| Molecular Weight | 246.14 |
| CAS Registry Number | 6217-24-9 |
| SMILES | C1=CC=CC=C1[As](C2=CC=CC=C2)O |
| InChI | 1S/C12H11AsO/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | BCAYVPQNDJXTHT-UHFFFAOYSA-N |
| Boiling point | 349.602°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenylhydroxyarsine |