|
CAS#: 6224-55-1 Product: 2-Methylbenzothiophene 1,1-Dioxide No suppilers available for the product. |
| Name | 2-Methylbenzothiophene 1,1-Dioxide |
|---|---|
| Synonyms | 2-Methylbenzothiophene 1,1-Dioxide; 2-Methylthianaphthene-1,1-Dioxide; Inchi=1/C9h8o2s/C1-7-6-8-4-2-3-5-9(8)12(7,10)11/H2-6H,1H |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.22 |
| CAS Registry Number | 6224-55-1 |
| SMILES | C1=CC=CC2=C1[S](=O)(=O)C(=C2)C |
| InChI | 1S/C9H8O2S/c1-7-6-8-4-2-3-5-9(8)12(7,10)11/h2-6H,1H3 |
| InChIKey | BRNMIIDEQOJZTP-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.135°C at 760 mmHg (Cal.) |
| Flash point | 233.154°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylbenzothiophene 1,1-Dioxide |