|
CAS#: 62267-71-4 Product: 2,5-Dihydroxy-3,6-Dimethoxy-2,5-Cyclohexadiene-1,4-Dione No suppilers available for the product. |
| Name | 2,5-Dihydroxy-3,6-Dimethoxy-2,5-Cyclohexadiene-1,4-Dione |
|---|---|
| Synonyms | 2,5-Dihydroxy-3,6-Dimethoxy-1,4-Benzoquinone; 2,5-Dihydroxy-3,6-Dimethoxy-P-Benzoquinone; 2,5-Dihydroxy-3,6-Dimethoxy-Cyclohexa-2,5-Diene-1,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 |
| CAS Registry Number | 62267-71-4 |
| SMILES | COC1=C(C(=O)C(=C(C1=O)O)OC)O |
| InChI | 1S/C8H8O6/c1-13-7-3(9)5(11)8(14-2)6(12)4(7)10/h9,12H,1-2H3 |
| InChIKey | BOEZUCUORQCPJY-UHFFFAOYSA-N |
| Density | 1.535g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.088°C at 760 mmHg (Cal.) |
| Flash point | 171.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dihydroxy-3,6-Dimethoxy-2,5-Cyclohexadiene-1,4-Dione |