Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Mordant Brown 48 |
|---|---|
| Synonyms | 6-[(2,4-Diamino-5-Chlorophenyl)Hydrazinylidene]-2,4-Dinitrocyclohexa-2,4-Dien-1-One; (6E)-6-[(2,4-Diamino-5-Chloro-Phenyl)Hydrazono]-2,4-Dinitro-Cyclohexa-2,4-Dien-1-One; 6-[(2,4-Diamino-5-Chloro-Phenyl)Hydrazono]-2,4-Dinitro-Cyclohexa-2,4-Dien-1-One |
| Molecular Structure |  |
| Molecular Formula | C12H9ClN6O5 |
| Molecular Weight | 352.69 |
| CAS Registry Number | 6232-53-7 |
| EINECS | 228-338-6 |
| SMILES | C2=C(N\N=C1\C(=O)C(=CC(=C1)[N+]([O-])=O)[N+]([O-])=O)C(=CC(=C2Cl)N)N |
| InChI | 1S/C12H9ClN6O5/c13-6-3-9(8(15)4-7(6)14)16-17-10-1-5(18(21)22)2-11(12(10)20)19(23)24/h1-4,16H,14-15H2/b17-10+ |
| InChIKey | UUQDSRYPLHNJSF-LICLKQGHSA-N |
| Density | 1.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.258°C at 760 mmHg (Cal.) |
| Flash point | 250.904°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mordant Brown 48 |