|
CAS#: 62327-35-9 Product: (4-Isothiocyanatophenyl)arsonic acid No suppilers available for the product. |
| Name | (4-Isothiocyanatophenyl)arsonic acid |
|---|---|
| Synonyms | Aabitc; Arsanil Isothiocyanate; Arsonic Acid Benzene Isothiocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6AsNO3S |
| Molecular Weight | 259.11 |
| CAS Registry Number | 62327-35-9 |
| SMILES | S=C=NC1=CC=C(C=C1)[As](O)(O)=O |
| InChI | 1S/C7H6AsNO3S/c10-8(11,12)6-1-3-7(4-2-6)9-5-13/h1-4H,(H2,10,11,12) |
| InChIKey | FJGCWJFFSBGALF-UHFFFAOYSA-N |
| Boiling point | 528.023°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 273.139°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Isothiocyanatophenyl)arsonic acid |